Overslaan naar inhoud

N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate (Sulfobetaine 12)10g

https://www.luchtwegportaal.com/web/image/product.template/33576/image_1920?unique=89c2bcc
N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate (Sulfobetaine 12) (CAS: 14933-08-5) has the chemical formula CH3(CH2)11N(CH3)2CH2CH2CH2SO3 and a molecular weight of 335.55 g/mol It typically appears as white pwdr. with a purity of nan and a flash point of nan commonly used in chemical synthesis or laboratory applications.

106,00 € 106.0 EUR 106,00 €

106,00 €

Not Available For Sale

Deze combinatie bestaat niet.

Algemene voorwaarden
30-dagen geld terug garantie
Verzending: 2-3 werkdagen